C22H31N3O3 — CID 126537614
tert-butyl N-[(1S)-1-[4-[(1S,2R)-2-(but-3-enylcarbamoyl)cyclopropyl]-2-pyridinyl]but-3-enyl]carbamate (PubChem CID 126537614) has the molecular formula C22H31N3O3 and a molecular weight of 385.51 g/mol. Its IUPAC name is tert-butyl N-[(1S)-1-[4-[(1S,2R)-2-(but-3-enylcarbamoyl)cyclopropyl]-2-pyridinyl]but-3-enyl]carbamate.
| Compound Name | tert-butyl N-[(1S)-1-[4-[(1S,2R)-2-(but-3-enylcarbamoyl)cyclopropyl]-2-pyridinyl]but-3-enyl]carbamate |
|---|---|
| PubChem CID | 126537614 |
| Molecular Formula | C22H31N3O3 |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.24 |
| IUPAC Name | tert-butyl N-[(1S)-1-[4-[(1S,2R)-2-(but-3-enylcarbamoyl)cyclopropyl]-2-pyridinyl]but-3-enyl]carbamate |
| SMILES | C=CCCNC(=O)[C@@H]1C[C@@H]1c1ccnc([C@H](CC=C)NC(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C22H31N3O3/c1-6-8-11-24-20(26)17-14-16(17)15-10-12-23-19(13-15)18(9-7-2)25-21(27)28-22(3,4)5/h6-7,10,12-13,16-18H,1-2,8-9,11,14H2,3-5H3,(H,24,26)(H,25,27)/t16-,17-,18+/m1/s1 |
| InChIKey | AYJZSZDXWVDFEU-KURKYZTESA-N |
| XLogP | 4.02 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|