C25H35N5O3 — CID 123965117
tert-butyl N-[1-[4-[1-methyl-4-(2-propan-2-ylbut-3-enoylamino)pyrazol-5-yl]-2-pyridinyl]but-3-enyl]carbamate (PubChem CID 123965117) has the molecular formula C25H35N5O3 and a molecular weight of 453.59 g/mol. Its IUPAC name is tert-butyl N-[1-[4-[1-methyl-4-(2-propan-2-ylbut-3-enoylamino)pyrazol-5-yl]-2-pyridinyl]but-3-enyl]carbamate.
| Compound Name | tert-butyl N-[1-[4-[1-methyl-4-(2-propan-2-ylbut-3-enoylamino)pyrazol-5-yl]-2-pyridinyl]but-3-enyl]carbamate |
|---|---|
| PubChem CID | 123965117 |
| Molecular Formula | C25H35N5O3 |
| Molecular Weight | 453.59 g/mol |
| Exact Mass | 453.27 |
| IUPAC Name | tert-butyl N-[1-[4-[1-methyl-4-(2-propan-2-ylbut-3-enoylamino)pyrazol-5-yl]-2-pyridinyl]but-3-enyl]carbamate |
| SMILES | C=CCC(NC(=O)OC(C)(C)C)c1cc(-c2c(NC(=O)C(C=C)C(C)C)cnn2C)ccn1 |
| InChI | InChI=1S/C25H35N5O3/c1-9-11-19(29-24(32)33-25(5,6)7)20-14-17(12-13-26-20)22-21(15-27-30(22)8)28-23(31)18(10-2)16(3)4/h9-10,12-16,18-19H,1-2,11H2,3-8H3,(H,28,31)(H,29,32) |
| InChIKey | ZDUXKHICBUPNNE-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 98.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.59 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|