C18H21F2N5O4 — CID 175334996
[(1S)-1-[5-[1-(difluoromethyl)-4-nitropyrazol-5-yl]-3-pyridinyl]but-3-enyl] N-tert-butylcarbamate (PubChem CID 175334996) has the molecular formula C18H21F2N5O4 and a molecular weight of 409.39 g/mol. Its IUPAC name is [(1S)-1-[5-[1-(difluoromethyl)-4-nitropyrazol-5-yl]-3-pyridinyl]but-3-enyl] N-tert-butylcarbamate.
| Compound Name | [(1S)-1-[5-[1-(difluoromethyl)-4-nitropyrazol-5-yl]-3-pyridinyl]but-3-enyl] N-tert-butylcarbamate |
|---|---|
| PubChem CID | 175334996 |
| Molecular Formula | C18H21F2N5O4 |
| Molecular Weight | 409.39 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | [(1S)-1-[5-[1-(difluoromethyl)-4-nitropyrazol-5-yl]-3-pyridinyl]but-3-enyl] N-tert-butylcarbamate |
| SMILES | C=CC[C@H](OC(=O)NC(C)(C)C)c1cncc(-c2c([N+](=O)[O-])cnn2C(F)F)c1 |
| InChI | InChI=1S/C18H21F2N5O4/c1-5-6-14(29-17(26)23-18(2,3)4)11-7-12(9-21-8-11)15-13(25(27)28)10-22-24(15)16(19)20/h5,7-10,14,16H,1,6H2,2-4H3,(H,23,26)/t14-/m0/s1 |
| InChIKey | IKIUNBPPCROICM-AWEZNQCLSA-N |
| XLogP | 4.39 |
| TPSA | 112.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.39 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|