C15H16F2N4O2 — CID 146371740
[(1S)-1-[3-[4-amino-1-(difluoromethyl)pyrazol-5-yl]phenyl]but-3-enyl]carbamic acid (PubChem CID 146371740) has the molecular formula C15H16F2N4O2 and a molecular weight of 322.32 g/mol. Its IUPAC name is [(1S)-1-[3-[4-amino-1-(difluoromethyl)pyrazol-5-yl]phenyl]but-3-enyl]carbamic acid.
| Compound Name | [(1S)-1-[3-[4-amino-1-(difluoromethyl)pyrazol-5-yl]phenyl]but-3-enyl]carbamic acid |
|---|---|
| PubChem CID | 146371740 |
| Molecular Formula | C15H16F2N4O2 |
| Molecular Weight | 322.32 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | [(1S)-1-[3-[4-amino-1-(difluoromethyl)pyrazol-5-yl]phenyl]but-3-enyl]carbamic acid |
| SMILES | C=CC[C@H](NC(=O)O)c1cccc(-c2c(N)cnn2C(F)F)c1 |
| InChI | InChI=1S/C15H16F2N4O2/c1-2-4-12(20-15(22)23)9-5-3-6-10(7-9)13-11(18)8-19-21(13)14(16)17/h2-3,5-8,12,14,20H,1,4,18H2,(H,22,23)/t12-/m0/s1 |
| InChIKey | KJXHWWYPTDDBRA-LBPRGKRZSA-N |
| XLogP | 3.41 |
| TPSA | 93.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.32 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|