C17H25ClN2O4 — CID 175599070
6-(4-chloro-2-pyridinyl)-2-methyl-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid (PubChem CID 175599070) has the molecular formula C17H25ClN2O4 and a molecular weight of 356.85 g/mol. Its IUPAC name is 6-(4-chloro-2-pyridinyl)-2-methyl-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid.
| Compound Name | 6-(4-chloro-2-pyridinyl)-2-methyl-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid |
|---|---|
| PubChem CID | 175599070 |
| Molecular Formula | C17H25ClN2O4 |
| Molecular Weight | 356.85 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | 6-(4-chloro-2-pyridinyl)-2-methyl-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid |
| SMILES | CC(CCCC(NC(=O)OC(C)(C)C)c1cc(Cl)ccn1)C(=O)O |
| InChI | InChI=1S/C17H25ClN2O4/c1-11(15(21)22)6-5-7-13(14-10-12(18)8-9-19-14)20-16(23)24-17(2,3)4/h8-11,13H,5-7H2,1-4H3,(H,20,23)(H,21,22) |
| InChIKey | DTNNIPBWPZFAQX-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.85 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |