C17H23ClN2O4 — CID 167015590
[(1R,2S)-1-(4-chloro-2-pyridinyl)-1-[(2-methylpropan-2-yl)oxycarbonylamino]but-3-en-2-yl] propanoate (PubChem CID 167015590) has the molecular formula C17H23ClN2O4 and a molecular weight of 354.83 g/mol. Its IUPAC name is [(1R,2S)-1-(4-chloro-2-pyridinyl)-1-[(2-methylpropan-2-yl)oxycarbonylamino]but-3-en-2-yl] propanoate.
| Compound Name | [(1R,2S)-1-(4-chloro-2-pyridinyl)-1-[(2-methylpropan-2-yl)oxycarbonylamino]but-3-en-2-yl] propanoate |
|---|---|
| PubChem CID | 167015590 |
| Molecular Formula | C17H23ClN2O4 |
| Molecular Weight | 354.83 g/mol |
| Exact Mass | 354.13 |
| IUPAC Name | [(1R,2S)-1-(4-chloro-2-pyridinyl)-1-[(2-methylpropan-2-yl)oxycarbonylamino]but-3-en-2-yl] propanoate |
| SMILES | C=C[C@H](OC(=O)CC)[C@H](NC(=O)OC(C)(C)C)c1cc(Cl)ccn1 |
| InChI | InChI=1S/C17H23ClN2O4/c1-6-13(23-14(21)7-2)15(12-10-11(18)8-9-19-12)20-16(22)24-17(3,4)5/h6,8-10,13,15H,1,7H2,2-5H3,(H,20,22)/t13-,15+/m0/s1 |
| InChIKey | PVCSYOYHDRKFEH-DZGCQCFKSA-N |
| XLogP | 3.81 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.83 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|