C19H21ClN2O2 — CID 122696483
tert-butyl N-[4-(4-chloro-2-methylphenyl)-3-ethenyl-2-pyridinyl]carbamate (PubChem CID 122696483) has the molecular formula C19H21ClN2O2 and a molecular weight of 344.84 g/mol. Its IUPAC name is tert-butyl N-[4-(4-chloro-2-methylphenyl)-3-ethenyl-2-pyridinyl]carbamate.
| Compound Name | tert-butyl N-[4-(4-chloro-2-methylphenyl)-3-ethenyl-2-pyridinyl]carbamate |
|---|---|
| PubChem CID | 122696483 |
| Molecular Formula | C19H21ClN2O2 |
| Molecular Weight | 344.84 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | tert-butyl N-[4-(4-chloro-2-methylphenyl)-3-ethenyl-2-pyridinyl]carbamate |
| SMILES | C=Cc1c(-c2ccc(Cl)cc2C)ccnc1NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H21ClN2O2/c1-6-14-16(15-8-7-13(20)11-12(15)2)9-10-21-17(14)22-18(23)24-19(3,4)5/h6-11H,1H2,2-5H3,(H,21,22,23) |
| InChIKey | WGERIRMPQCYDJW-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.84 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |