C18H26ClNO3 — CID 165340535
tert-butyl N-[1-(4-chlorophenoxy)-3,3-dimethylpent-4-en-2-yl]carbamate (PubChem CID 165340535) has the molecular formula C18H26ClNO3 and a molecular weight of 339.86 g/mol. Its IUPAC name is tert-butyl N-[1-(4-chlorophenoxy)-3,3-dimethylpent-4-en-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-(4-chlorophenoxy)-3,3-dimethylpent-4-en-2-yl]carbamate |
|---|---|
| PubChem CID | 165340535 |
| Molecular Formula | C18H26ClNO3 |
| Molecular Weight | 339.86 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | tert-butyl N-[1-(4-chlorophenoxy)-3,3-dimethylpent-4-en-2-yl]carbamate |
| SMILES | C=CC(C)(C)C(COc1ccc(Cl)cc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H26ClNO3/c1-7-18(5,6)15(20-16(21)23-17(2,3)4)12-22-14-10-8-13(19)9-11-14/h7-11,15H,1,12H2,2-6H3,(H,20,21) |
| InChIKey | FFDVUBXOJZSSMB-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.86 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|