C20H23ClN2O3S — CID 174001652
[[(1R,2S)-2-benzoyloxy-1-(4-chloro-2-pyridinyl)but-3-enyl]amino]-tert-butyl-oxidosulfanium (PubChem CID 174001652) has the molecular formula C20H23ClN2O3S and a molecular weight of 406.94 g/mol. Its IUPAC name is [[(1R,2S)-2-benzoyloxy-1-(4-chloro-2-pyridinyl)but-3-enyl]amino]-tert-butyl-oxidosulfanium.
| Compound Name | [[(1R,2S)-2-benzoyloxy-1-(4-chloro-2-pyridinyl)but-3-enyl]amino]-tert-butyl-oxidosulfanium |
|---|---|
| PubChem CID | 174001652 |
| Molecular Formula | C20H23ClN2O3S |
| Molecular Weight | 406.94 g/mol |
| Exact Mass | 406.11 |
| IUPAC Name | [[(1R,2S)-2-benzoyloxy-1-(4-chloro-2-pyridinyl)but-3-enyl]amino]-tert-butyl-oxidosulfanium |
| SMILES | C=C[C@H](OC(=O)c1ccccc1)[C@H](N[S+]([O-])C(C)(C)C)c1cc(Cl)ccn1 |
| InChI | InChI=1S/C20H23ClN2O3S/c1-5-17(26-19(24)14-9-7-6-8-10-14)18(23-27(25)20(2,3)4)16-13-15(21)11-12-22-16/h5-13,17-18,23H,1H2,2-4H3/t17-,18+,27?/m0/s1 |
| InChIKey | HMLATRNFNDMRFK-RIGXQMBPSA-N |
| XLogP | 4.24 |
| TPSA | 74.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.94 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|