About 1-cyanoprop-2-enyl benzoate
1-cyanoprop-2-enyl benzoate (PubChem CID 13229624) has the molecular formula C11H9NO2
and a molecular weight of 187.20 g/mol. Its IUPAC name is 1-cyanoprop-2-enyl benzoate.
Molecular Properties
| Compound Name | 1-cyanoprop-2-enyl benzoate |
| PubChem CID | 13229624 |
| Molecular Formula | C11H9NO2 |
| Molecular Weight | 187.20 g/mol |
| Exact Mass | 187.06 |
| IUPAC Name | 1-cyanoprop-2-enyl benzoate |
| SMILES | C=CC(C#N)OC(=O)c1ccccc1 |
| InChI | InChI=1S/C11H9NO2/c1-2-10(8-12)14-11(13)9-6-4-3-5-7-9/h2-7,10H,1H2 |
| InChIKey | ORZCOWHWVRRLRC-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.20 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-cyanoprop-2-enyl benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyanoprop-2-enyl benzoate?
The IUPAC name of 1-cyanoprop-2-enyl benzoate (CID 13229624) is 1-cyanoprop-2-enyl benzoate.
What is the SMILES notation for 1-cyanoprop-2-enyl benzoate?
The canonical SMILES for 1-cyanoprop-2-enyl benzoate is C=CC(C#N)OC(=O)c1ccccc1.
What is the InChIKey of 1-cyanoprop-2-enyl benzoate?
The InChIKey is ORZCOWHWVRRLRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9NO2/c1-2-10(8-12)14-11(13)9-6-4-3-5-7-9/h2-7,10H,1H2.
What are the key properties of 1-cyanoprop-2-enyl benzoate?
1-cyanoprop-2-enyl benzoate has a molecular weight of 187.20 g/mol, XLogP of 1.92, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyanoprop-2-enyl benzoate is sourced from PubChem (CID 13229624), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).