C20H25N5O6 — CID 131736630
tert-butyl N-[(1S)-1-[5-[4-(methoxycarbonylamino)-2-nitrophenyl]-1H-imidazol-2-yl]but-3-enyl]carbamate (PubChem CID 131736630) has the molecular formula C20H25N5O6 and a molecular weight of 431.45 g/mol. Its IUPAC name is tert-butyl N-[(1S)-1-[5-[4-(methoxycarbonylamino)-2-nitrophenyl]-1H-imidazol-2-yl]but-3-enyl]carbamate.
| Compound Name | tert-butyl N-[(1S)-1-[5-[4-(methoxycarbonylamino)-2-nitrophenyl]-1H-imidazol-2-yl]but-3-enyl]carbamate |
|---|---|
| PubChem CID | 131736630 |
| Molecular Formula | C20H25N5O6 |
| Molecular Weight | 431.45 g/mol |
| Exact Mass | 431.18 |
| IUPAC Name | tert-butyl N-[(1S)-1-[5-[4-(methoxycarbonylamino)-2-nitrophenyl]-1H-imidazol-2-yl]but-3-enyl]carbamate |
| SMILES | C=CC[C@H](NC(=O)OC(C)(C)C)c1ncc(-c2ccc(NC(=O)OC)cc2[N+](=O)[O-])[nH]1 |
| InChI | InChI=1S/C20H25N5O6/c1-6-7-14(24-19(27)31-20(2,3)4)17-21-11-15(23-17)13-9-8-12(22-18(26)30-5)10-16(13)25(28)29/h6,8-11,14H,1,7H2,2-5H3,(H,21,23)(H,22,26)(H,24,27)/t14-/m0/s1 |
| InChIKey | HZAVMGVVASECRU-AWEZNQCLSA-N |
| XLogP | 4.31 |
| TPSA | 148.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.45 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|