C24H26BrN5O6 — CID 67378227
tert-butyl N-(3-bromophenyl)-N-[2-[5-[4-(methoxycarbonylamino)-2-nitrophenyl]-1H-imidazol-2-yl]ethyl]carbamate (PubChem CID 67378227) has the molecular formula C24H26BrN5O6 and a molecular weight of 560.41 g/mol. Its IUPAC name is tert-butyl N-(3-bromophenyl)-N-[2-[5-[4-(methoxycarbonylamino)-2-nitrophenyl]-1H-imidazol-2-yl]ethyl]carbamate.
| Compound Name | tert-butyl N-(3-bromophenyl)-N-[2-[5-[4-(methoxycarbonylamino)-2-nitrophenyl]-1H-imidazol-2-yl]ethyl]carbamate |
|---|---|
| PubChem CID | 67378227 |
| Molecular Formula | C24H26BrN5O6 |
| Molecular Weight | 560.41 g/mol |
| Exact Mass | 559.11 |
| IUPAC Name | tert-butyl N-(3-bromophenyl)-N-[2-[5-[4-(methoxycarbonylamino)-2-nitrophenyl]-1H-imidazol-2-yl]ethyl]carbamate |
| SMILES | COC(=O)Nc1ccc(-c2cnc(CCN(C(=O)OC(C)(C)C)c3cccc(Br)c3)[nH]2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C24H26BrN5O6/c1-24(2,3)36-23(32)29(17-7-5-6-15(25)12-17)11-10-21-26-14-19(28-21)18-9-8-16(27-22(31)35-4)13-20(18)30(33)34/h5-9,12-14H,10-11H2,1-4H3,(H,26,28)(H,27,31) |
| InChIKey | HZUPXILFFPVFLI-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 139.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.41 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|