C18H22N4O5 — CID 68871818
tert-butyl N-[3-[[4-(ethylamino)-5-nitro-2-pyridinyl]oxy]phenyl]carbamate (PubChem CID 68871818) has the molecular formula C18H22N4O5 and a molecular weight of 374.40 g/mol. Its IUPAC name is tert-butyl N-[3-[[4-(ethylamino)-5-nitro-2-pyridinyl]oxy]phenyl]carbamate.
| Compound Name | tert-butyl N-[3-[[4-(ethylamino)-5-nitro-2-pyridinyl]oxy]phenyl]carbamate |
|---|---|
| PubChem CID | 68871818 |
| Molecular Formula | C18H22N4O5 |
| Molecular Weight | 374.40 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | tert-butyl N-[3-[[4-(ethylamino)-5-nitro-2-pyridinyl]oxy]phenyl]carbamate |
| SMILES | CCNc1cc(Oc2cccc(NC(=O)OC(C)(C)C)c2)ncc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H22N4O5/c1-5-19-14-10-16(20-11-15(14)22(24)25)26-13-8-6-7-12(9-13)21-17(23)27-18(2,3)4/h6-11H,5H2,1-4H3,(H,19,20)(H,21,23) |
| InChIKey | CDLLOGCZJJIHSO-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 115.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.40 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|