C21H24N4O2 — CID 118280006
tert-butyl N-[(1S)-1-[5-(2-amino-4-cyanophenyl)-3-pyridinyl]but-3-enyl]carbamate (PubChem CID 118280006) has the molecular formula C21H24N4O2 and a molecular weight of 364.45 g/mol. Its IUPAC name is tert-butyl N-[(1S)-1-[5-(2-amino-4-cyanophenyl)-3-pyridinyl]but-3-enyl]carbamate.
| Compound Name | tert-butyl N-[(1S)-1-[5-(2-amino-4-cyanophenyl)-3-pyridinyl]but-3-enyl]carbamate |
|---|---|
| PubChem CID | 118280006 |
| Molecular Formula | C21H24N4O2 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | tert-butyl N-[(1S)-1-[5-(2-amino-4-cyanophenyl)-3-pyridinyl]but-3-enyl]carbamate |
| SMILES | C=CC[C@H](NC(=O)OC(C)(C)C)c1cncc(-c2ccc(C#N)cc2N)c1 |
| InChI | InChI=1S/C21H24N4O2/c1-5-6-19(25-20(26)27-21(2,3)4)16-10-15(12-24-13-16)17-8-7-14(11-22)9-18(17)23/h5,7-10,12-13,19H,1,6,23H2,2-4H3,(H,25,26)/t19-/m0/s1 |
| InChIKey | OQGLDBUCSVJFAA-IBGZPJMESA-N |
| XLogP | 4.34 |
| TPSA | 101.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|