C26H30N4O3 — CID 123653509
tert-butyl N-[1-[5-[4-cyano-2-(2-methylbut-3-enoylamino)phenyl]-3-pyridinyl]but-3-enyl]carbamate (PubChem CID 123653509) has the molecular formula C26H30N4O3 and a molecular weight of 446.55 g/mol. Its IUPAC name is tert-butyl N-[1-[5-[4-cyano-2-(2-methylbut-3-enoylamino)phenyl]-3-pyridinyl]but-3-enyl]carbamate.
| Compound Name | tert-butyl N-[1-[5-[4-cyano-2-(2-methylbut-3-enoylamino)phenyl]-3-pyridinyl]but-3-enyl]carbamate |
|---|---|
| PubChem CID | 123653509 |
| Molecular Formula | C26H30N4O3 |
| Molecular Weight | 446.55 g/mol |
| Exact Mass | 446.23 |
| IUPAC Name | tert-butyl N-[1-[5-[4-cyano-2-(2-methylbut-3-enoylamino)phenyl]-3-pyridinyl]but-3-enyl]carbamate |
| SMILES | C=CCC(NC(=O)OC(C)(C)C)c1cncc(-c2ccc(C#N)cc2NC(=O)C(C)C=C)c1 |
| InChI | InChI=1S/C26H30N4O3/c1-7-9-22(30-25(32)33-26(4,5)6)20-13-19(15-28-16-20)21-11-10-18(14-27)12-23(21)29-24(31)17(3)8-2/h7-8,10-13,15-17,22H,1-2,9H2,3-6H3,(H,29,31)(H,30,32) |
| InChIKey | IMFAVTDSEXVWNJ-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 104.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.55 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|