C19H28N2O4 — CID 140891185
methyl (2R)-2-amino-3-[3-[(1S)-1-[(2-methylpropan-2-yl)oxycarbonylamino]but-3-enyl]phenyl]propanoate (PubChem CID 140891185) has the molecular formula C19H28N2O4 and a molecular weight of 348.44 g/mol. Its IUPAC name is methyl (2R)-2-amino-3-[3-[(1S)-1-[(2-methylpropan-2-yl)oxycarbonylamino]but-3-enyl]phenyl]propanoate.
| Compound Name | methyl (2R)-2-amino-3-[3-[(1S)-1-[(2-methylpropan-2-yl)oxycarbonylamino]but-3-enyl]phenyl]propanoate |
|---|---|
| PubChem CID | 140891185 |
| Molecular Formula | C19H28N2O4 |
| Molecular Weight | 348.44 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | methyl (2R)-2-amino-3-[3-[(1S)-1-[(2-methylpropan-2-yl)oxycarbonylamino]but-3-enyl]phenyl]propanoate |
| SMILES | C=CC[C@H](NC(=O)OC(C)(C)C)c1cccc(C[C@@H](N)C(=O)OC)c1 |
| InChI | InChI=1S/C19H28N2O4/c1-6-8-16(21-18(23)25-19(2,3)4)14-10-7-9-13(11-14)12-15(20)17(22)24-5/h6-7,9-11,15-16H,1,8,12,20H2,2-5H3,(H,21,23)/t15-,16+/m1/s1 |
| InChIKey | JARVXAPLZJRLGX-CVEARBPZSA-N |
| XLogP | 2.87 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.44 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|