C26H34N2O5 — CID 126507683
benzyl N-[(1S)-1-[3-[(2R)-3-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]phenyl]but-3-enyl]carbamate (PubChem CID 126507683) has the molecular formula C26H34N2O5 and a molecular weight of 454.57 g/mol. Its IUPAC name is benzyl N-[(1S)-1-[3-[(2R)-3-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]phenyl]but-3-enyl]carbamate.
| Compound Name | benzyl N-[(1S)-1-[3-[(2R)-3-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]phenyl]but-3-enyl]carbamate |
|---|---|
| PubChem CID | 126507683 |
| Molecular Formula | C26H34N2O5 |
| Molecular Weight | 454.57 g/mol |
| Exact Mass | 454.25 |
| IUPAC Name | benzyl N-[(1S)-1-[3-[(2R)-3-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]phenyl]but-3-enyl]carbamate |
| SMILES | C=CC[C@H](NC(=O)OCc1ccccc1)c1cccc(C[C@H](CO)NC(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C26H34N2O5/c1-5-10-23(28-24(30)32-18-19-11-7-6-8-12-19)21-14-9-13-20(15-21)16-22(17-29)27-25(31)33-26(2,3)4/h5-9,11-15,22-23,29H,1,10,16-18H2,2-4H3,(H,27,31)(H,28,30)/t22-,23+/m1/s1 |
| InChIKey | HXBNIWVSZFMMEJ-PKTZIBPZSA-N |
| XLogP | 4.66 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.57 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|