C23H26N2O3 — CID 175075739
benzyl N-[(1S)-1-[3-(4-amino-3-methyl-4-oxobut-1-en-2-yl)phenyl]but-3-enyl]carbamate (PubChem CID 175075739) has the molecular formula C23H26N2O3 and a molecular weight of 378.47 g/mol. Its IUPAC name is benzyl N-[(1S)-1-[3-(4-amino-3-methyl-4-oxobut-1-en-2-yl)phenyl]but-3-enyl]carbamate.
| Compound Name | benzyl N-[(1S)-1-[3-(4-amino-3-methyl-4-oxobut-1-en-2-yl)phenyl]but-3-enyl]carbamate |
|---|---|
| PubChem CID | 175075739 |
| Molecular Formula | C23H26N2O3 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.19 |
| IUPAC Name | benzyl N-[(1S)-1-[3-(4-amino-3-methyl-4-oxobut-1-en-2-yl)phenyl]but-3-enyl]carbamate |
| SMILES | C=CC[C@H](NC(=O)OCc1ccccc1)c1cccc(C(=C)C(C)C(N)=O)c1 |
| InChI | InChI=1S/C23H26N2O3/c1-4-9-21(25-23(27)28-15-18-10-6-5-7-11-18)20-13-8-12-19(14-20)16(2)17(3)22(24)26/h4-8,10-14,17,21H,1-2,9,15H2,3H3,(H2,24,26)(H,25,27)/t17?,21-/m0/s1 |
| InChIKey | ZTXJQDKBFFLPDJ-LFABVHOISA-N |
| XLogP | 4.36 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|