C27H41N5O7Si — CID 123263810
tert-butyl N-[(14S)-5-(methoxycarbonylamino)-9-oxo-16-(2-trimethylsilylethoxymethyl)-10-oxa-8,16,18-triazatricyclo[13.2.1.02,7]octadeca-1(17),2(7),3,5,15(18)-pentaen-14-yl]carbamate (PubChem CID 123263810) has the molecular formula C27H41N5O7Si and a molecular weight of 575.74 g/mol. Its IUPAC name is tert-butyl N-[(14S)-5-(methoxycarbonylamino)-9-oxo-16-(2-trimethylsilylethoxymethyl)-10-oxa-8,16,18-triazatricyclo[13.2.1.02,7]octadeca-1(17),2(7),3,5,15(18)-pentaen-14-yl]carbamate.
| Compound Name | tert-butyl N-[(14S)-5-(methoxycarbonylamino)-9-oxo-16-(2-trimethylsilylethoxymethyl)-10-oxa-8,16,18-triazatricyclo[13.2.1.02,7]octadeca-1(17),2(7),3,5,15(18)-pentaen-14-yl]carbamate |
|---|---|
| PubChem CID | 123263810 |
| Molecular Formula | C27H41N5O7Si |
| Molecular Weight | 575.74 g/mol |
| Exact Mass | 575.28 |
| IUPAC Name | tert-butyl N-[(14S)-5-(methoxycarbonylamino)-9-oxo-16-(2-trimethylsilylethoxymethyl)-10-oxa-8,16,18-triazatricyclo[13.2.1.02,7]octadeca-1(17),2(7),3,5,15(18)-pentaen-14-yl]carbamate |
| SMILES | COC(=O)Nc1ccc2c(c1)NC(=O)OCCC[C@H](NC(=O)OC(C)(C)C)c1nc-2cn1COCC[Si](C)(C)C |
| InChI | InChI=1S/C27H41N5O7Si/c1-27(2,3)39-26(35)30-20-9-8-12-38-25(34)31-21-15-18(28-24(33)36-4)10-11-19(21)22-16-32(23(20)29-22)17-37-13-14-40(5,6)7/h10-11,15-16,20H,8-9,12-14,17H2,1-7H3,(H,28,33)(H,30,35)(H,31,34)/t20-/m0/s1 |
| InChIKey | FYNXZDFHOVZFMV-FQEVSTJZSA-N |
| XLogP | 5.95 |
| TPSA | 142.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.74 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|