C26H39N3O4Si — CID 71073389
tert-butyl N-[16-(2-trimethylsilylethoxymethyl)-8-oxa-16,18-diazatricyclo[13.2.1.02,7]octadeca-1(17),2,4,6,11,15(18)-hexaen-14-yl]carbamate (PubChem CID 71073389) has the molecular formula C26H39N3O4Si and a molecular weight of 485.70 g/mol. Its IUPAC name is tert-butyl N-[16-(2-trimethylsilylethoxymethyl)-8-oxa-16,18-diazatricyclo[13.2.1.02,7]octadeca-1(17),2,4,6,11,15(18)-hexaen-14-yl]carbamate.
| Compound Name | tert-butyl N-[16-(2-trimethylsilylethoxymethyl)-8-oxa-16,18-diazatricyclo[13.2.1.02,7]octadeca-1(17),2,4,6,11,15(18)-hexaen-14-yl]carbamate |
|---|---|
| PubChem CID | 71073389 |
| Molecular Formula | C26H39N3O4Si |
| Molecular Weight | 485.70 g/mol |
| Exact Mass | 485.27 |
| IUPAC Name | tert-butyl N-[16-(2-trimethylsilylethoxymethyl)-8-oxa-16,18-diazatricyclo[13.2.1.02,7]octadeca-1(17),2,4,6,11,15(18)-hexaen-14-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CC=CCCOc2ccccc2-c2cn(COCC[Si](C)(C)C)c1n2 |
| InChI | InChI=1S/C26H39N3O4Si/c1-26(2,3)33-25(30)28-21-13-8-7-11-15-32-23-14-10-9-12-20(23)22-18-29(24(21)27-22)19-31-16-17-34(4,5)6/h7-10,12,14,18,21H,11,13,15-17,19H2,1-6H3,(H,28,30) |
| InChIKey | IXIFEANFYLJVNQ-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 74.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.70 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|