C27H43N5O4Si — CID 140649385
tert-butyl N-[(10R,14S)-5-amino-10-methyl-9-oxo-16-(2-trimethylsilylethoxymethyl)-8,16,18-triazatricyclo[13.2.1.02,7]octadeca-1(17),2(7),3,5,15(18)-pentaen-14-yl]carbamate (PubChem CID 140649385) has the molecular formula C27H43N5O4Si and a molecular weight of 529.76 g/mol. Its IUPAC name is tert-butyl N-[(10R,14S)-5-amino-10-methyl-9-oxo-16-(2-trimethylsilylethoxymethyl)-8,16,18-triazatricyclo[13.2.1.02,7]octadeca-1(17),2(7),3,5,15(18)-pentaen-14-yl]carbamate.
| Compound Name | tert-butyl N-[(10R,14S)-5-amino-10-methyl-9-oxo-16-(2-trimethylsilylethoxymethyl)-8,16,18-triazatricyclo[13.2.1.02,7]octadeca-1(17),2(7),3,5,15(18)-pentaen-14-yl]carbamate |
|---|---|
| PubChem CID | 140649385 |
| Molecular Formula | C27H43N5O4Si |
| Molecular Weight | 529.76 g/mol |
| Exact Mass | 529.31 |
| IUPAC Name | tert-butyl N-[(10R,14S)-5-amino-10-methyl-9-oxo-16-(2-trimethylsilylethoxymethyl)-8,16,18-triazatricyclo[13.2.1.02,7]octadeca-1(17),2(7),3,5,15(18)-pentaen-14-yl]carbamate |
| SMILES | C[C@@H]1CCC[C@H](NC(=O)OC(C)(C)C)c2nc(cn2COCC[Si](C)(C)C)-c2ccc(N)cc2NC1=O |
| InChI | InChI=1S/C27H43N5O4Si/c1-18-9-8-10-21(31-26(34)36-27(2,3)4)24-29-23(16-32(24)17-35-13-14-37(5,6)7)20-12-11-19(28)15-22(20)30-25(18)33/h11-12,15-16,18,21H,8-10,13-14,17,28H2,1-7H3,(H,30,33)(H,31,34)/t18-,21+/m1/s1 |
| InChIKey | CNRRAESOMULHIU-NQIIRXRSSA-N |
| XLogP | 5.77 |
| TPSA | 120.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.76 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|