C29H46N4O4Si — CID 88588156
tert-butyl N-[(Z,1S)-5-methyl-1-[4-[2-(methylamino)phenyl]-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]-7-oxohept-3-enyl]carbamate (PubChem CID 88588156) has the molecular formula C29H46N4O4Si and a molecular weight of 542.80 g/mol. Its IUPAC name is tert-butyl N-[(Z,1S)-5-methyl-1-[4-[2-(methylamino)phenyl]-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]-7-oxohept-3-enyl]carbamate.
| Compound Name | tert-butyl N-[(Z,1S)-5-methyl-1-[4-[2-(methylamino)phenyl]-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]-7-oxohept-3-enyl]carbamate |
|---|---|
| PubChem CID | 88588156 |
| Molecular Formula | C29H46N4O4Si |
| Molecular Weight | 542.80 g/mol |
| Exact Mass | 542.33 |
| IUPAC Name | tert-butyl N-[(Z,1S)-5-methyl-1-[4-[2-(methylamino)phenyl]-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]-7-oxohept-3-enyl]carbamate |
| SMILES | CNc1ccccc1-c1cn(COCC[Si](C)(C)C)c([C@H](C/C=C\C(C)CC=O)NC(=O)OC(C)(C)C)n1 |
| InChI | InChI=1S/C29H46N4O4Si/c1-22(16-17-34)12-11-15-25(32-28(35)37-29(2,3)4)27-31-26(23-13-9-10-14-24(23)30-5)20-33(27)21-36-18-19-38(6,7)8/h9-14,17,20,22,25,30H,15-16,18-19,21H2,1-8H3,(H,32,35)/b12-11-/t22?,25-/m0/s1 |
| InChIKey | KMNFLELZZLFRBW-AZJUIPGKSA-N |
| XLogP | 6.64 |
| TPSA | 94.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.80 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|