C29H42F3N5O6Si — CID 87133255
tert-butyl N-[(1S)-1-[4-[4-(methoxycarbonylamino)-2-[(2,2,2-trifluoroacetyl)amino]phenyl]-5-methyl-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]but-3-enyl]carbamate (PubChem CID 87133255) has the molecular formula C29H42F3N5O6Si and a molecular weight of 641.76 g/mol. Its IUPAC name is tert-butyl N-[(1S)-1-[4-[4-(methoxycarbonylamino)-2-[(2,2,2-trifluoroacetyl)amino]phenyl]-5-methyl-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]but-3-enyl]carbamate.
| Compound Name | tert-butyl N-[(1S)-1-[4-[4-(methoxycarbonylamino)-2-[(2,2,2-trifluoroacetyl)amino]phenyl]-5-methyl-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]but-3-enyl]carbamate |
|---|---|
| PubChem CID | 87133255 |
| Molecular Formula | C29H42F3N5O6Si |
| Molecular Weight | 641.76 g/mol |
| Exact Mass | 641.29 |
| IUPAC Name | tert-butyl N-[(1S)-1-[4-[4-(methoxycarbonylamino)-2-[(2,2,2-trifluoroacetyl)amino]phenyl]-5-methyl-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]but-3-enyl]carbamate |
| SMILES | C=CC[C@H](NC(=O)OC(C)(C)C)c1nc(-c2ccc(NC(=O)OC)cc2NC(=O)C(F)(F)F)c(C)n1COCC[Si](C)(C)C |
| InChI | InChI=1S/C29H42F3N5O6Si/c1-10-11-21(35-27(40)43-28(3,4)5)24-36-23(18(2)37(24)17-42-14-15-44(7,8)9)20-13-12-19(33-26(39)41-6)16-22(20)34-25(38)29(30,31)32/h10,12-13,16,21H,1,11,14-15,17H2,2-9H3,(H,33,39)(H,34,38)(H,35,40)/t21-/m0/s1 |
| InChIKey | JUWDFFMFCDTFAB-NRFANRHFSA-N |
| XLogP | 6.99 |
| TPSA | 132.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.76 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|