C32H49N5O6Si — CID 66744132
tert-butyl N-[2-[4-[4-(methoxycarbonylamino)-2-prop-2-enylphenyl]-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]ethyl]-N-[methyl(prop-2-enyl)carbamoyl]carbamate (PubChem CID 66744132) has the molecular formula C32H49N5O6Si and a molecular weight of 627.86 g/mol. Its IUPAC name is tert-butyl N-[2-[4-[4-(methoxycarbonylamino)-2-prop-2-enylphenyl]-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]ethyl]-N-[methyl(prop-2-enyl)carbamoyl]carbamate.
| Compound Name | tert-butyl N-[2-[4-[4-(methoxycarbonylamino)-2-prop-2-enylphenyl]-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]ethyl]-N-[methyl(prop-2-enyl)carbamoyl]carbamate |
|---|---|
| PubChem CID | 66744132 |
| Molecular Formula | C32H49N5O6Si |
| Molecular Weight | 627.86 g/mol |
| Exact Mass | 627.35 |
| IUPAC Name | tert-butyl N-[2-[4-[4-(methoxycarbonylamino)-2-prop-2-enylphenyl]-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]ethyl]-N-[methyl(prop-2-enyl)carbamoyl]carbamate |
| SMILES | C=CCc1cc(NC(=O)OC)ccc1-c1cn(COCC[Si](C)(C)C)c(CCN(C(=O)OC(C)(C)C)C(=O)N(C)CC=C)n1 |
| InChI | InChI=1S/C32H49N5O6Si/c1-11-13-24-21-25(33-29(38)41-7)14-15-26(24)27-22-36(23-42-19-20-44(8,9)10)28(34-27)16-18-37(30(39)35(6)17-12-2)31(40)43-32(3,4)5/h11-12,14-15,21-22H,1-2,13,16-20,23H2,3-10H3,(H,33,38) |
| InChIKey | GGKAMGOQPVVUSO-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 115.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.86 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|