C22H30BrFN2O3Si — CID 140936911
ethyl 2-[4-(2-bromo-4-fluorophenyl)-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]pent-4-enoate (PubChem CID 140936911) has the molecular formula C22H30BrFN2O3Si and a molecular weight of 497.48 g/mol. Its IUPAC name is ethyl 2-[4-(2-bromo-4-fluorophenyl)-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]pent-4-enoate.
| Compound Name | ethyl 2-[4-(2-bromo-4-fluorophenyl)-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]pent-4-enoate |
|---|---|
| PubChem CID | 140936911 |
| Molecular Formula | C22H30BrFN2O3Si |
| Molecular Weight | 497.48 g/mol |
| Exact Mass | 496.12 |
| IUPAC Name | ethyl 2-[4-(2-bromo-4-fluorophenyl)-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]pent-4-enoate |
| SMILES | C=CCC(C(=O)OCC)c1nc(-c2ccc(F)cc2Br)cn1COCC[Si](C)(C)C |
| InChI | InChI=1S/C22H30BrFN2O3Si/c1-6-8-18(22(27)29-7-2)21-25-20(17-10-9-16(24)13-19(17)23)14-26(21)15-28-11-12-30(3,4)5/h6,9-10,13-14,18H,1,7-8,11-12,15H2,2-5H3 |
| InChIKey | HKZFLBWYGVFSJF-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.48 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|