C18H22BrFO5 — CID 145303846
1-O-[2-(2-bromo-4-fluorophenyl)-2-oxoethyl] 3-O-ethyl 2-prop-2-enylpropanedioate;ethane (PubChem CID 145303846) has the molecular formula C18H22BrFO5 and a molecular weight of 417.27 g/mol. Its IUPAC name is 1-O-[2-(2-bromo-4-fluorophenyl)-2-oxoethyl] 3-O-ethyl 2-prop-2-enylpropanedioate;ethane.
| Compound Name | 1-O-[2-(2-bromo-4-fluorophenyl)-2-oxoethyl] 3-O-ethyl 2-prop-2-enylpropanedioate;ethane |
|---|---|
| PubChem CID | 145303846 |
| Molecular Formula | C18H22BrFO5 |
| Molecular Weight | 417.27 g/mol |
| Exact Mass | 416.06 |
| IUPAC Name | 1-O-[2-(2-bromo-4-fluorophenyl)-2-oxoethyl] 3-O-ethyl 2-prop-2-enylpropanedioate;ethane |
| SMILES | C=CCC(C(=O)OCC)C(=O)OCC(=O)c1ccc(F)cc1Br.CC |
| InChI | InChI=1S/C16H16BrFO5.C2H6/c1-3-5-12(15(20)22-4-2)16(21)23-9-14(19)11-7-6-10(18)8-13(11)17;1-2/h3,6-8,12H,1,4-5,9H2,2H3;1-2H3 |
| InChIKey | XIRHSKKJDGNFPP-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.27 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|