C17H23F2N3O4SSi — CID 140912300
2-[[5-[2-(difluoromethoxy)-5-methylsulfanylphenyl]-4-nitropyrazol-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 140912300) has the molecular formula C17H23F2N3O4SSi and a molecular weight of 431.54 g/mol. Its IUPAC name is 2-[[5-[2-(difluoromethoxy)-5-methylsulfanylphenyl]-4-nitropyrazol-1-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[5-[2-(difluoromethoxy)-5-methylsulfanylphenyl]-4-nitropyrazol-1-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 140912300 |
| Molecular Formula | C17H23F2N3O4SSi |
| Molecular Weight | 431.54 g/mol |
| Exact Mass | 431.11 |
| IUPAC Name | 2-[[5-[2-(difluoromethoxy)-5-methylsulfanylphenyl]-4-nitropyrazol-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | CSc1ccc(OC(F)F)c(-c2c([N+](=O)[O-])cnn2COCC[Si](C)(C)C)c1 |
| InChI | InChI=1S/C17H23F2N3O4SSi/c1-27-12-5-6-15(26-17(18)19)13(9-12)16-14(22(23)24)10-20-21(16)11-25-7-8-28(2,3)4/h5-6,9-10,17H,7-8,11H2,1-4H3 |
| InChIKey | CDOOCMVLMOEBGR-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 79.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.54 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|