C17H22N4O6 — CID 123315560
tert-butyl N-[1-[2-(2-nitrobenzoyl)hydrazinyl]-1-oxopent-4-en-2-yl]carbamate (PubChem CID 123315560) has the molecular formula C17H22N4O6 and a molecular weight of 378.39 g/mol. Its IUPAC name is tert-butyl N-[1-[2-(2-nitrobenzoyl)hydrazinyl]-1-oxopent-4-en-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[2-(2-nitrobenzoyl)hydrazinyl]-1-oxopent-4-en-2-yl]carbamate |
|---|---|
| PubChem CID | 123315560 |
| Molecular Formula | C17H22N4O6 |
| Molecular Weight | 378.39 g/mol |
| Exact Mass | 378.15 |
| IUPAC Name | tert-butyl N-[1-[2-(2-nitrobenzoyl)hydrazinyl]-1-oxopent-4-en-2-yl]carbamate |
| SMILES | C=CCC(NC(=O)OC(C)(C)C)C(=O)NNC(=O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H22N4O6/c1-5-8-12(18-16(24)27-17(2,3)4)15(23)20-19-14(22)11-9-6-7-10-13(11)21(25)26/h5-7,9-10,12H,1,8H2,2-4H3,(H,18,24)(H,19,22)(H,20,23) |
| InChIKey | OBWJNDXNSYDAQO-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 139.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.39 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|