C26H35NO6Si — CID 67654418
[2-[(2-methylpropan-2-yl)oxycarbonylamino]-6-[1-oxo-1-(2-trimethylsilylethoxy)propan-2-yl]phenyl] benzoate (PubChem CID 67654418) has the molecular formula C26H35NO6Si and a molecular weight of 485.65 g/mol. Its IUPAC name is [2-[(2-methylpropan-2-yl)oxycarbonylamino]-6-[1-oxo-1-(2-trimethylsilylethoxy)propan-2-yl]phenyl] benzoate.
| Compound Name | [2-[(2-methylpropan-2-yl)oxycarbonylamino]-6-[1-oxo-1-(2-trimethylsilylethoxy)propan-2-yl]phenyl] benzoate |
|---|---|
| PubChem CID | 67654418 |
| Molecular Formula | C26H35NO6Si |
| Molecular Weight | 485.65 g/mol |
| Exact Mass | 485.22 |
| IUPAC Name | [2-[(2-methylpropan-2-yl)oxycarbonylamino]-6-[1-oxo-1-(2-trimethylsilylethoxy)propan-2-yl]phenyl] benzoate |
| SMILES | CC(C(=O)OCC[Si](C)(C)C)c1cccc(NC(=O)OC(C)(C)C)c1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C26H35NO6Si/c1-18(23(28)31-16-17-34(5,6)7)20-14-11-15-21(27-25(30)33-26(2,3)4)22(20)32-24(29)19-12-9-8-10-13-19/h8-15,18H,16-17H2,1-7H3,(H,27,30) |
| InChIKey | QWYQTXBREZTOKS-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.65 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|