C16H25NO3 — CID 18457008
tert-butyl N-[2-(2-hydroxy-4-propan-2-ylphenyl)ethyl]carbamate (PubChem CID 18457008) has the molecular formula C16H25NO3 and a molecular weight of 279.38 g/mol. Its IUPAC name is tert-butyl N-[2-(2-hydroxy-4-propan-2-ylphenyl)ethyl]carbamate.
| Compound Name | tert-butyl N-[2-(2-hydroxy-4-propan-2-ylphenyl)ethyl]carbamate |
|---|---|
| PubChem CID | 18457008 |
| Molecular Formula | C16H25NO3 |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.18 |
| IUPAC Name | tert-butyl N-[2-(2-hydroxy-4-propan-2-ylphenyl)ethyl]carbamate |
| SMILES | CC(C)c1ccc(CCNC(=O)OC(C)(C)C)c(O)c1 |
| InChI | InChI=1S/C16H25NO3/c1-11(2)13-7-6-12(14(18)10-13)8-9-17-15(19)20-16(3,4)5/h6-7,10-11,18H,8-9H2,1-5H3,(H,17,19) |
| InChIKey | LEWIEWIDMLZJDW-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |