C19H27N3O4 — CID 118248881
tert-butyl N-[2-[2-(ethylcarbamoyl)-5-methoxy-1H-indol-3-yl]ethyl]carbamate (PubChem CID 118248881) has the molecular formula C19H27N3O4 and a molecular weight of 361.44 g/mol. Its IUPAC name is tert-butyl N-[2-[2-(ethylcarbamoyl)-5-methoxy-1H-indol-3-yl]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[2-(ethylcarbamoyl)-5-methoxy-1H-indol-3-yl]ethyl]carbamate |
|---|---|
| PubChem CID | 118248881 |
| Molecular Formula | C19H27N3O4 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.20 |
| IUPAC Name | tert-butyl N-[2-[2-(ethylcarbamoyl)-5-methoxy-1H-indol-3-yl]ethyl]carbamate |
| SMILES | CCNC(=O)c1[nH]c2ccc(OC)cc2c1CCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H27N3O4/c1-6-20-17(23)16-13(9-10-21-18(24)26-19(2,3)4)14-11-12(25-5)7-8-15(14)22-16/h7-8,11,22H,6,9-10H2,1-5H3,(H,20,23)(H,21,24) |
| InChIKey | XFYSBYICJOFELS-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 92.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|