C24H23F6N3O3 — CID 155545459
methyl N-[2-[2-[C-[3,5-bis(trifluoromethyl)phenyl]-N-ethylcarbonimidoyl]-5-methoxy-1H-indol-3-yl]ethyl]carbamate (PubChem CID 155545459) has the molecular formula C24H23F6N3O3 and a molecular weight of 515.45 g/mol. Its IUPAC name is methyl N-[2-[2-[C-[3,5-bis(trifluoromethyl)phenyl]-N-ethylcarbonimidoyl]-5-methoxy-1H-indol-3-yl]ethyl]carbamate.
| Compound Name | methyl N-[2-[2-[C-[3,5-bis(trifluoromethyl)phenyl]-N-ethylcarbonimidoyl]-5-methoxy-1H-indol-3-yl]ethyl]carbamate |
|---|---|
| PubChem CID | 155545459 |
| Molecular Formula | C24H23F6N3O3 |
| Molecular Weight | 515.45 g/mol |
| Exact Mass | 515.16 |
| IUPAC Name | methyl N-[2-[2-[C-[3,5-bis(trifluoromethyl)phenyl]-N-ethylcarbonimidoyl]-5-methoxy-1H-indol-3-yl]ethyl]carbamate |
| SMILES | CC/N=C(\c1cc(C(F)(F)F)cc(C(F)(F)F)c1)c1[nH]c2ccc(OC)cc2c1CCNC(=O)OC |
| InChI | InChI=1S/C24H23F6N3O3/c1-4-31-20(13-9-14(23(25,26)27)11-15(10-13)24(28,29)30)21-17(7-8-32-22(34)36-3)18-12-16(35-2)5-6-19(18)33-21/h5-6,9-12,33H,4,7-8H2,1-3H3,(H,32,34)/b31-20+ |
| InChIKey | JXOJOQCCVGTZGI-AJBULDERSA-N |
| XLogP | 5.97 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.45 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|