C16H22N4O3 — CID 118071542
3-[2-(ethylcarbamoylamino)ethyl]-5-methoxy-N-methyl-1H-indole-2-carboxamide (PubChem CID 118071542) has the molecular formula C16H22N4O3 and a molecular weight of 318.38 g/mol. Its IUPAC name is 3-[2-(ethylcarbamoylamino)ethyl]-5-methoxy-N-methyl-1H-indole-2-carboxamide.
| Compound Name | 3-[2-(ethylcarbamoylamino)ethyl]-5-methoxy-N-methyl-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 118071542 |
| Molecular Formula | C16H22N4O3 |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.17 |
| IUPAC Name | 3-[2-(ethylcarbamoylamino)ethyl]-5-methoxy-N-methyl-1H-indole-2-carboxamide |
| SMILES | CCNC(=O)NCCc1c(C(=O)NC)[nH]c2ccc(OC)cc12 |
| InChI | InChI=1S/C16H22N4O3/c1-4-18-16(22)19-8-7-11-12-9-10(23-3)5-6-13(12)20-14(11)15(21)17-2/h5-6,9,20H,4,7-8H2,1-3H3,(H,17,21)(H2,18,19,22) |
| InChIKey | SCEASVRWLSIFRR-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 95.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|