C18H24N2O2 — CID 23360900
1-ethyl-3-[2-(3-ethyl-7-methoxynaphthalen-1-yl)ethyl]urea (PubChem CID 23360900) has the molecular formula C18H24N2O2 and a molecular weight of 300.40 g/mol. Its IUPAC name is 1-ethyl-3-[2-(3-ethyl-7-methoxynaphthalen-1-yl)ethyl]urea.
| Compound Name | 1-ethyl-3-[2-(3-ethyl-7-methoxynaphthalen-1-yl)ethyl]urea |
|---|---|
| PubChem CID | 23360900 |
| Molecular Formula | C18H24N2O2 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.18 |
| IUPAC Name | 1-ethyl-3-[2-(3-ethyl-7-methoxynaphthalen-1-yl)ethyl]urea |
| SMILES | CCNC(=O)NCCc1cc(CC)cc2ccc(OC)cc12 |
| InChI | InChI=1S/C18H24N2O2/c1-4-13-10-14-6-7-16(22-3)12-17(14)15(11-13)8-9-20-18(21)19-5-2/h6-7,10-12H,4-5,8-9H2,1-3H3,(H2,19,20,21) |
| InChIKey | FWWXWIQPCHGZGP-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |