N-[2-(7-methoxynaphthalen-1-yl)ethyl]acetamide;sulfuric acid

C15H19NO6S — CID 71529133

IUPACN-[2-(7-methoxynaphthalen-1-yl)ethyl]acetamide;sulfuric acid
SMILESCOc1ccc2cccc(CCNC(C)=O)c2c1.O=S(=O)(O)O
InChIInChI=1S/C15H17NO2.H2O4S/c1-11(17)16-9-8-13-5-3-4-12-6-7-14(18-2)10-15(12)13;1-5(2,3)4/h3-7,10H,8-9H2,1-2H3,(H,16,17);(H2,1,2,3,4)
InChIKeyCVYWXGAIVIIVIV-UHFFFAOYSA-N
MW341.39 g/mol
LogP1.87
Rot. Bonds4

About N-[2-(7-methoxynaphthalen-1-yl)ethyl]acetamide;sulfuric acid

N-[2-(7-methoxynaphthalen-1-yl)ethyl]acetamide;sulfuric acid (PubChem CID 71529133) has the molecular formula C15H19NO6S and a molecular weight of 341.39 g/mol. Its IUPAC name is N-[2-(7-methoxynaphthalen-1-yl)ethyl]acetamide;sulfuric acid.

Molecular Properties

Compound NameN-[2-(7-methoxynaphthalen-1-yl)ethyl]acetamide;sulfuric acid
PubChem CID71529133
Molecular FormulaC15H19NO6S
Molecular Weight341.39 g/mol
Exact Mass341.09
IUPAC NameN-[2-(7-methoxynaphthalen-1-yl)ethyl]acetamide;sulfuric acid
SMILESCOc1ccc2cccc(CCNC(C)=O)c2c1.O=S(=O)(O)O
InChIInChI=1S/C15H17NO2.H2O4S/c1-11(17)16-9-8-13-5-3-4-12-6-7-14(18-2)10-15(12)13;1-5(2,3)4/h3-7,10H,8-9H2,1-2H3,(H,16,17);(H2,1,2,3,4)
InChIKeyCVYWXGAIVIIVIV-UHFFFAOYSA-N
XLogP1.87
TPSA112.93 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms23
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500341.39
LogP ≤ 51.87
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze N-[2-(7-methoxynaphthalen-1-yl)ethyl]acetamide;sulfuric acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of N-[2-(7-methoxynaphthalen-1-yl)ethyl]acetamide;sulfuric acid?
The IUPAC name of N-[2-(7-methoxynaphthalen-1-yl)ethyl]acetamide;sulfuric acid (CID 71529133) is N-[2-(7-methoxynaphthalen-1-yl)ethyl]acetamide;sulfuric acid.
What is the SMILES notation for N-[2-(7-methoxynaphthalen-1-yl)ethyl]acetamide;sulfuric acid?
The canonical SMILES for N-[2-(7-methoxynaphthalen-1-yl)ethyl]acetamide;sulfuric acid is COc1ccc2cccc(CCNC(C)=O)c2c1.O=S(=O)(O)O.
What is the InChIKey of N-[2-(7-methoxynaphthalen-1-yl)ethyl]acetamide;sulfuric acid?
The InChIKey is CVYWXGAIVIIVIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17NO2.H2O4S/c1-11(17)16-9-8-13-5-3-4-12-6-7-14(18-2)10-15(12)13;1-5(2,3)4/h3-7,10H,8-9H2,1-2H3,(H,16,17);(H2,1,2,3,4).
What are the key properties of N-[2-(7-methoxynaphthalen-1-yl)ethyl]acetamide;sulfuric acid?
N-[2-(7-methoxynaphthalen-1-yl)ethyl]acetamide;sulfuric acid has a molecular weight of 341.39 g/mol, XLogP of 1.87, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(7-methoxynaphthalen-1-yl)ethyl]acetamide;sulfuric acid is sourced from PubChem (CID 71529133), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).