C15H19NO6S — CID 71529133
N-[2-(7-methoxynaphthalen-1-yl)ethyl]acetamide;sulfuric acid (PubChem CID 71529133) has the molecular formula C15H19NO6S and a molecular weight of 341.39 g/mol. Its IUPAC name is N-[2-(7-methoxynaphthalen-1-yl)ethyl]acetamide;sulfuric acid.
| Compound Name | N-[2-(7-methoxynaphthalen-1-yl)ethyl]acetamide;sulfuric acid |
|---|---|
| PubChem CID | 71529133 |
| Molecular Formula | C15H19NO6S |
| Molecular Weight | 341.39 g/mol |
| Exact Mass | 341.09 |
| IUPAC Name | N-[2-(7-methoxynaphthalen-1-yl)ethyl]acetamide;sulfuric acid |
| SMILES | COc1ccc2cccc(CCNC(C)=O)c2c1.O=S(=O)(O)O |
| InChI | InChI=1S/C15H17NO2.H2O4S/c1-11(17)16-9-8-13-5-3-4-12-6-7-14(18-2)10-15(12)13;1-5(2,3)4/h3-7,10H,8-9H2,1-2H3,(H,16,17);(H2,1,2,3,4) |
| InChIKey | CVYWXGAIVIIVIV-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.39 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|