C16H21NO3 — CID 174597749
methanol;N-[2-(7-methoxynaphthalen-1-yl)ethyl]acetamide (PubChem CID 174597749) has the molecular formula C16H21NO3 and a molecular weight of 275.35 g/mol. Its IUPAC name is methanol;N-[2-(7-methoxynaphthalen-1-yl)ethyl]acetamide.
| Compound Name | methanol;N-[2-(7-methoxynaphthalen-1-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 174597749 |
| Molecular Formula | C16H21NO3 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | methanol;N-[2-(7-methoxynaphthalen-1-yl)ethyl]acetamide |
| SMILES | CO.COc1ccc2cccc(CCNC(C)=O)c2c1 |
| InChI | InChI=1S/C15H17NO2.CH4O/c1-11(17)16-9-8-13-5-3-4-12-6-7-14(18-2)10-15(12)13;1-2/h3-7,10H,8-9H2,1-2H3,(H,16,17);2H,1H3 |
| InChIKey | FYFCCNDHYOFASU-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |