C18H21NO6 — CID 71477284
N-[2-(7-methoxynaphthalen-1-yl)ethyl]acetamide;propanedioic acid (PubChem CID 71477284) has the molecular formula C18H21NO6 and a molecular weight of 347.37 g/mol. Its IUPAC name is N-[2-(7-methoxynaphthalen-1-yl)ethyl]acetamide;propanedioic acid.
| Compound Name | N-[2-(7-methoxynaphthalen-1-yl)ethyl]acetamide;propanedioic acid |
|---|---|
| PubChem CID | 71477284 |
| Molecular Formula | C18H21NO6 |
| Molecular Weight | 347.37 g/mol |
| Exact Mass | 347.14 |
| IUPAC Name | N-[2-(7-methoxynaphthalen-1-yl)ethyl]acetamide;propanedioic acid |
| SMILES | COc1ccc2cccc(CCNC(C)=O)c2c1.O=C(O)CC(=O)O |
| InChI | InChI=1S/C15H17NO2.C3H4O4/c1-11(17)16-9-8-13-5-3-4-12-6-7-14(18-2)10-15(12)13;4-2(5)1-3(6)7/h3-7,10H,8-9H2,1-2H3,(H,16,17);1H2,(H,4,5)(H,6,7) |
| InChIKey | XVIOGGMRSBUQTR-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.37 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|