C22H24F3N3O2 — CID 45268310
N-[2-[5-methoxy-2-[[N-methyl-4-(trifluoromethyl)anilino]methyl]-1H-indol-3-yl]ethyl]acetamide (PubChem CID 45268310) has the molecular formula C22H24F3N3O2 and a molecular weight of 419.45 g/mol. Its IUPAC name is N-[2-[5-methoxy-2-[[N-methyl-4-(trifluoromethyl)anilino]methyl]-1H-indol-3-yl]ethyl]acetamide.
| Compound Name | N-[2-[5-methoxy-2-[[N-methyl-4-(trifluoromethyl)anilino]methyl]-1H-indol-3-yl]ethyl]acetamide |
|---|---|
| PubChem CID | 45268310 |
| Molecular Formula | C22H24F3N3O2 |
| Molecular Weight | 419.45 g/mol |
| Exact Mass | 419.18 |
| IUPAC Name | N-[2-[5-methoxy-2-[[N-methyl-4-(trifluoromethyl)anilino]methyl]-1H-indol-3-yl]ethyl]acetamide |
| SMILES | COc1ccc2[nH]c(CN(C)c3ccc(C(F)(F)F)cc3)c(CCNC(C)=O)c2c1 |
| InChI | InChI=1S/C22H24F3N3O2/c1-14(29)26-11-10-18-19-12-17(30-3)8-9-20(19)27-21(18)13-28(2)16-6-4-15(5-7-16)22(23,24)25/h4-9,12,27H,10-11,13H2,1-3H3,(H,26,29) |
| InChIKey | WQYNWUPUMDNUPV-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.45 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|