C14H15N5O — CID 115265690
4-N-(1,3-benzoxazol-6-ylmethyl)-6-N-ethylpyrimidine-4,6-diamine (PubChem CID 115265690) has the molecular formula C14H15N5O and a molecular weight of 269.31 g/mol. Its IUPAC name is 4-N-(1,3-benzoxazol-6-ylmethyl)-6-N-ethylpyrimidine-4,6-diamine.
| Compound Name | 4-N-(1,3-benzoxazol-6-ylmethyl)-6-N-ethylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 115265690 |
| Molecular Formula | C14H15N5O |
| Molecular Weight | 269.31 g/mol |
| Exact Mass | 269.13 |
| IUPAC Name | 4-N-(1,3-benzoxazol-6-ylmethyl)-6-N-ethylpyrimidine-4,6-diamine |
| SMILES | CCNc1cc(NCc2ccc3ncoc3c2)ncn1 |
| InChI | InChI=1S/C14H15N5O/c1-2-15-13-6-14(18-8-17-13)16-7-10-3-4-11-12(5-10)20-9-19-11/h3-6,8-9H,2,7H2,1H3,(H2,15,16,17,18) |
| InChIKey | GGYDVWXCILVOFV-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 75.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.31 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |