C13H10N6O — CID 115266618
[6-(1,3-benzoxazol-6-ylamino)-2-methylpyrimidin-4-yl]cyanamide (PubChem CID 115266618) has the molecular formula C13H10N6O and a molecular weight of 266.26 g/mol. Its IUPAC name is [6-(1,3-benzoxazol-6-ylamino)-2-methylpyrimidin-4-yl]cyanamide.
| Compound Name | [6-(1,3-benzoxazol-6-ylamino)-2-methylpyrimidin-4-yl]cyanamide |
|---|---|
| PubChem CID | 115266618 |
| Molecular Formula | C13H10N6O |
| Molecular Weight | 266.26 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | [6-(1,3-benzoxazol-6-ylamino)-2-methylpyrimidin-4-yl]cyanamide |
| SMILES | Cc1nc(NC#N)cc(Nc2ccc3ncoc3c2)n1 |
| InChI | InChI=1S/C13H10N6O/c1-8-17-12(15-6-14)5-13(18-8)19-9-2-3-10-11(4-9)20-7-16-10/h2-5,7H,1H3,(H2,15,17,18,19) |
| InChIKey | WICCEJQOCPGKOH-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 99.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.26 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|