C18H13N3O3 — CID 175495895
3-(1,3-benzoxazol-6-ylamino)-4-(3-methylanilino)cyclobut-3-ene-1,2-dione (PubChem CID 175495895) has the molecular formula C18H13N3O3 and a molecular weight of 319.32 g/mol. Its IUPAC name is 3-(1,3-benzoxazol-6-ylamino)-4-(3-methylanilino)cyclobut-3-ene-1,2-dione.
| Compound Name | 3-(1,3-benzoxazol-6-ylamino)-4-(3-methylanilino)cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 175495895 |
| Molecular Formula | C18H13N3O3 |
| Molecular Weight | 319.32 g/mol |
| Exact Mass | 319.10 |
| IUPAC Name | 3-(1,3-benzoxazol-6-ylamino)-4-(3-methylanilino)cyclobut-3-ene-1,2-dione |
| SMILES | Cc1cccc(Nc2c(Nc3ccc4ncoc4c3)c(=O)c2=O)c1 |
| InChI | InChI=1S/C18H13N3O3/c1-10-3-2-4-11(7-10)20-15-16(18(23)17(15)22)21-12-5-6-13-14(8-12)24-9-19-13/h2-9,20-21H,1H3 |
| InChIKey | CGNIJYXJXQPKOA-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.32 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|