C19H15N3O3 — CID 175495910
3-(1,3-benzoxazol-6-ylamino)-4-(3-ethylanilino)cyclobut-3-ene-1,2-dione (PubChem CID 175495910) has the molecular formula C19H15N3O3 and a molecular weight of 333.35 g/mol. Its IUPAC name is 3-(1,3-benzoxazol-6-ylamino)-4-(3-ethylanilino)cyclobut-3-ene-1,2-dione.
| Compound Name | 3-(1,3-benzoxazol-6-ylamino)-4-(3-ethylanilino)cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 175495910 |
| Molecular Formula | C19H15N3O3 |
| Molecular Weight | 333.35 g/mol |
| Exact Mass | 333.11 |
| IUPAC Name | 3-(1,3-benzoxazol-6-ylamino)-4-(3-ethylanilino)cyclobut-3-ene-1,2-dione |
| SMILES | CCc1cccc(Nc2c(Nc3ccc4ncoc4c3)c(=O)c2=O)c1 |
| InChI | InChI=1S/C19H15N3O3/c1-2-11-4-3-5-12(8-11)21-16-17(19(24)18(16)23)22-13-6-7-14-15(9-13)25-10-20-14/h3-10,21-22H,2H2,1H3 |
| InChIKey | JSXFKGBNRGRWNN-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.35 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|