C15H12N2O3 — CID 115221838
4-[(1,3-benzoxazol-6-ylamino)methyl]benzoic acid (PubChem CID 115221838) has the molecular formula C15H12N2O3 and a molecular weight of 268.27 g/mol. Its IUPAC name is 4-[(1,3-benzoxazol-6-ylamino)methyl]benzoic acid.
| Compound Name | 4-[(1,3-benzoxazol-6-ylamino)methyl]benzoic acid |
|---|---|
| PubChem CID | 115221838 |
| Molecular Formula | C15H12N2O3 |
| Molecular Weight | 268.27 g/mol |
| Exact Mass | 268.08 |
| IUPAC Name | 4-[(1,3-benzoxazol-6-ylamino)methyl]benzoic acid |
| SMILES | O=C(O)c1ccc(CNc2ccc3ncoc3c2)cc1 |
| InChI | InChI=1S/C15H12N2O3/c18-15(19)11-3-1-10(2-4-11)8-16-12-5-6-13-14(7-12)20-9-17-13/h1-7,9,16H,8H2,(H,18,19) |
| InChIKey | XQHPBRXOMKPUQP-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 75.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.27 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |