C8H8N2OS — CID 115227656
(1,3-benzoxazol-6-ylamino)methanethiol (PubChem CID 115227656) has the molecular formula C8H8N2OS and a molecular weight of 180.23 g/mol. Its IUPAC name is (1,3-benzoxazol-6-ylamino)methanethiol.
| Compound Name | (1,3-benzoxazol-6-ylamino)methanethiol |
|---|---|
| PubChem CID | 115227656 |
| Molecular Formula | C8H8N2OS |
| Molecular Weight | 180.23 g/mol |
| Exact Mass | 180.04 |
| IUPAC Name | (1,3-benzoxazol-6-ylamino)methanethiol |
| SMILES | SCNc1ccc2ncoc2c1 |
| InChI | InChI=1S/C8H8N2OS/c12-5-10-6-1-2-7-8(3-6)11-4-9-7/h1-4,10,12H,5H2 |
| InChIKey | SBVHMJWYYSFYRI-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.23 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|