3-[(1,3-benzoxazol-6-ylamino)methyl]benzoic acid

C15H12N2O3 — CID 115221776

IUPAC3-[(1,3-benzoxazol-6-ylamino)methyl]benzoic acid
SMILESO=C(O)c1cccc(CNc2ccc3ncoc3c2)c1
InChIInChI=1S/C15H12N2O3/c18-15(19)11-3-1-2-10(6-11)8-16-12-4-5-13-14(7-12)20-9-17-13/h1-7,9,16H,8H2,(H,18,19)
InChIKeyIIYWMVPNBQJDOP-UHFFFAOYSA-N
MW268.27 g/mol
LogP3.14
Rot. Bonds4

About 3-[(1,3-benzoxazol-6-ylamino)methyl]benzoic acid

3-[(1,3-benzoxazol-6-ylamino)methyl]benzoic acid (PubChem CID 115221776) has the molecular formula C15H12N2O3 and a molecular weight of 268.27 g/mol. Its IUPAC name is 3-[(1,3-benzoxazol-6-ylamino)methyl]benzoic acid.

Molecular Properties

Compound Name3-[(1,3-benzoxazol-6-ylamino)methyl]benzoic acid
PubChem CID115221776
Molecular FormulaC15H12N2O3
Molecular Weight268.27 g/mol
Exact Mass268.08
IUPAC Name3-[(1,3-benzoxazol-6-ylamino)methyl]benzoic acid
SMILESO=C(O)c1cccc(CNc2ccc3ncoc3c2)c1
InChIInChI=1S/C15H12N2O3/c18-15(19)11-3-1-2-10(6-11)8-16-12-4-5-13-14(7-12)20-9-17-13/h1-7,9,16H,8H2,(H,18,19)
InChIKeyIIYWMVPNBQJDOP-UHFFFAOYSA-N
XLogP3.14
TPSA75.36 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500268.27
LogP ≤ 53.14
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 3-[(1,3-benzoxazol-6-ylamino)methyl]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[(1,3-benzoxazol-6-ylamino)methyl]benzoic acid?
The IUPAC name of 3-[(1,3-benzoxazol-6-ylamino)methyl]benzoic acid (CID 115221776) is 3-[(1,3-benzoxazol-6-ylamino)methyl]benzoic acid.
What is the SMILES notation for 3-[(1,3-benzoxazol-6-ylamino)methyl]benzoic acid?
The canonical SMILES for 3-[(1,3-benzoxazol-6-ylamino)methyl]benzoic acid is O=C(O)c1cccc(CNc2ccc3ncoc3c2)c1.
What is the InChIKey of 3-[(1,3-benzoxazol-6-ylamino)methyl]benzoic acid?
The InChIKey is IIYWMVPNBQJDOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12N2O3/c18-15(19)11-3-1-2-10(6-11)8-16-12-4-5-13-14(7-12)20-9-17-13/h1-7,9,16H,8H2,(H,18,19).
What are the key properties of 3-[(1,3-benzoxazol-6-ylamino)methyl]benzoic acid?
3-[(1,3-benzoxazol-6-ylamino)methyl]benzoic acid has a molecular weight of 268.27 g/mol, XLogP of 3.14, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(1,3-benzoxazol-6-ylamino)methyl]benzoic acid is sourced from PubChem (CID 115221776), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).