C12H12N2O4 — CID 115248308
3-[(1,3-benzoxazol-6-ylamino)methyl]oxetane-3-carboxylic acid (PubChem CID 115248308) has the molecular formula C12H12N2O4 and a molecular weight of 248.24 g/mol. Its IUPAC name is 3-[(1,3-benzoxazol-6-ylamino)methyl]oxetane-3-carboxylic acid.
| Compound Name | 3-[(1,3-benzoxazol-6-ylamino)methyl]oxetane-3-carboxylic acid |
|---|---|
| PubChem CID | 115248308 |
| Molecular Formula | C12H12N2O4 |
| Molecular Weight | 248.24 g/mol |
| Exact Mass | 248.08 |
| IUPAC Name | 3-[(1,3-benzoxazol-6-ylamino)methyl]oxetane-3-carboxylic acid |
| SMILES | O=C(O)C1(CNc2ccc3ncoc3c2)COC1 |
| InChI | InChI=1S/C12H12N2O4/c15-11(16)12(5-17-6-12)4-13-8-1-2-9-10(3-8)18-7-14-9/h1-3,7,13H,4-6H2,(H,15,16) |
| InChIKey | DDGAWYVZGANWLD-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 84.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.24 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |