C13H16BrFN2OS — CID 140674060
(4R)-4-(5-bromo-2-fluorophenyl)-4-cyano-2-methylpentane-2-sulfinamide (PubChem CID 140674060) has the molecular formula C13H16BrFN2OS and a molecular weight of 347.25 g/mol. Its IUPAC name is (4R)-4-(5-bromo-2-fluorophenyl)-4-cyano-2-methylpentane-2-sulfinamide.
| Compound Name | (4R)-4-(5-bromo-2-fluorophenyl)-4-cyano-2-methylpentane-2-sulfinamide |
|---|---|
| PubChem CID | 140674060 |
| Molecular Formula | C13H16BrFN2OS |
| Molecular Weight | 347.25 g/mol |
| Exact Mass | 346.02 |
| IUPAC Name | (4R)-4-(5-bromo-2-fluorophenyl)-4-cyano-2-methylpentane-2-sulfinamide |
| SMILES | CC(C)(C[C@@](C)(C#N)c1cc(Br)ccc1F)S(N)=O |
| InChI | InChI=1S/C13H16BrFN2OS/c1-12(2,19(17)18)7-13(3,8-16)10-6-9(14)4-5-11(10)15/h4-6H,7,17H2,1-3H3/t13-,19?/m0/s1 |
| InChIKey | QDECLSLFDCQSFZ-YTJLLHSVSA-N |
| XLogP | 3.16 |
| TPSA | 66.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.25 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |