C17H29N3O — CID 60995327
2-[2-(diethylamino)ethylamino]-2-(2,5-dimethylphenyl)propanamide (PubChem CID 60995327) has the molecular formula C17H29N3O and a molecular weight of 291.44 g/mol. Its IUPAC name is 2-[2-(diethylamino)ethylamino]-2-(2,5-dimethylphenyl)propanamide.
| Compound Name | 2-[2-(diethylamino)ethylamino]-2-(2,5-dimethylphenyl)propanamide |
|---|---|
| PubChem CID | 60995327 |
| Molecular Formula | C17H29N3O |
| Molecular Weight | 291.44 g/mol |
| Exact Mass | 291.23 |
| IUPAC Name | 2-[2-(diethylamino)ethylamino]-2-(2,5-dimethylphenyl)propanamide |
| SMILES | CCN(CC)CCNC(C)(C(N)=O)c1cc(C)ccc1C |
| InChI | InChI=1S/C17H29N3O/c1-6-20(7-2)11-10-19-17(5,16(18)21)15-12-13(3)8-9-14(15)4/h8-9,12,19H,6-7,10-11H2,1-5H3,(H2,18,21) |
| InChIKey | IFFOHTPXJYJJQH-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.44 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |