C11H18BrN3O2 — CID 104653361
2-(5-bromofuran-2-yl)-2-[2-(dimethylamino)ethylamino]propanamide (PubChem CID 104653361) has the molecular formula C11H18BrN3O2 and a molecular weight of 304.19 g/mol. Its IUPAC name is 2-(5-bromofuran-2-yl)-2-[2-(dimethylamino)ethylamino]propanamide.
| Compound Name | 2-(5-bromofuran-2-yl)-2-[2-(dimethylamino)ethylamino]propanamide |
|---|---|
| PubChem CID | 104653361 |
| Molecular Formula | C11H18BrN3O2 |
| Molecular Weight | 304.19 g/mol |
| Exact Mass | 303.06 |
| IUPAC Name | 2-(5-bromofuran-2-yl)-2-[2-(dimethylamino)ethylamino]propanamide |
| SMILES | CN(C)CCNC(C)(C(N)=O)c1ccc(Br)o1 |
| InChI | InChI=1S/C11H18BrN3O2/c1-11(10(13)16,14-6-7-15(2)3)8-4-5-9(12)17-8/h4-5,14H,6-7H2,1-3H3,(H2,13,16) |
| InChIKey | DJOBKHZBHSQTCW-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 71.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.19 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |