C9H10BrF3N2O2 — CID 104653438
2-(5-bromofuran-2-yl)-2-(2,2,2-trifluoroethylamino)propanamide (PubChem CID 104653438) has the molecular formula C9H10BrF3N2O2 and a molecular weight of 315.09 g/mol. Its IUPAC name is 2-(5-bromofuran-2-yl)-2-(2,2,2-trifluoroethylamino)propanamide.
| Compound Name | 2-(5-bromofuran-2-yl)-2-(2,2,2-trifluoroethylamino)propanamide |
|---|---|
| PubChem CID | 104653438 |
| Molecular Formula | C9H10BrF3N2O2 |
| Molecular Weight | 315.09 g/mol |
| Exact Mass | 313.99 |
| IUPAC Name | 2-(5-bromofuran-2-yl)-2-(2,2,2-trifluoroethylamino)propanamide |
| SMILES | CC(NCC(F)(F)F)(C(N)=O)c1ccc(Br)o1 |
| InChI | InChI=1S/C9H10BrF3N2O2/c1-8(7(14)16,15-4-9(11,12)13)5-2-3-6(10)17-5/h2-3,15H,4H2,1H3,(H2,14,16) |
| InChIKey | ULRKPJAMVVMPDC-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 68.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.09 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |